C21H30N2O3 — CID 123915519
propan-2-yl 4-acetyl-7-hex-5-en-3-yl-3-methyl-2,3-dihydroquinoxaline-1-carboxylate (PubChem CID 123915519) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is propan-2-yl 4-acetyl-7-hex-5-en-3-yl-3-methyl-2,3-dihydroquinoxaline-1-carboxylate.
| Compound Name | propan-2-yl 4-acetyl-7-hex-5-en-3-yl-3-methyl-2,3-dihydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 123915519 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | propan-2-yl 4-acetyl-7-hex-5-en-3-yl-3-methyl-2,3-dihydroquinoxaline-1-carboxylate |
| SMILES | C=CCC(CC)c1ccc2c(c1)N(C(=O)OC(C)C)CC(C)N2C(C)=O |
| InChI | InChI=1S/C21H30N2O3/c1-7-9-17(8-2)18-10-11-19-20(12-18)22(21(25)26-14(3)4)13-15(5)23(19)16(6)24/h7,10-12,14-15,17H,1,8-9,13H2,2-6H3 |
| InChIKey | AJGAGDBWSFZMMO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|