C42H79N3 — CID 123916330
N'-heptatriaconta-6,9,28,31-tetraen-19-yl-2-methyliminobutane-1,4-diamine (PubChem CID 123916330) has the molecular formula C42H79N3 and a molecular weight of 626.11 g/mol. Its IUPAC name is N'-heptatriaconta-6,9,28,31-tetraen-19-yl-2-methyliminobutane-1,4-diamine.
| Compound Name | N'-heptatriaconta-6,9,28,31-tetraen-19-yl-2-methyliminobutane-1,4-diamine |
|---|---|
| PubChem CID | 123916330 |
| Molecular Formula | C42H79N3 |
| Molecular Weight | 626.11 g/mol |
| Exact Mass | 625.63 |
| IUPAC Name | N'-heptatriaconta-6,9,28,31-tetraen-19-yl-2-methyliminobutane-1,4-diamine |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(CCCCCCCCC=CCC=CCCCCC)NCC/C(CN)=N/C |
| InChI | InChI=1S/C42H79N3/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-41(45-39-38-42(40-43)44-3)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,41,45H,4-11,16-17,22-40,43H2,1-3H3/b14-12?,15-13?,20-18?,21-19?,44-42- |
| InChIKey | FBAXZQUVWHOXDS-MUVNYMTISA-N |
| XLogP | 12.77 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.11 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|