About 4-ethenoxybutyl 4-methyl-4H-pyridine-1-carboxylate
4-ethenoxybutyl 4-methyl-4H-pyridine-1-carboxylate (PubChem CID 123916373) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-ethenoxybutyl 4-methyl-4H-pyridine-1-carboxylate.
Molecular Properties
| Compound Name | 4-ethenoxybutyl 4-methyl-4H-pyridine-1-carboxylate |
| PubChem CID | 123916373 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 4-ethenoxybutyl 4-methyl-4H-pyridine-1-carboxylate |
| SMILES | C=COCCCCOC(=O)N1C=CC(C)C=C1 |
| InChI | InChI=1S/C13H19NO3/c1-3-16-10-4-5-11-17-13(15)14-8-6-12(2)7-9-14/h3,6-9,12H,1,4-5,10-11H2,2H3 |
| InChIKey | PQGRIPSWZNZBSL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenoxybutyl 4-methyl-4H-pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenoxybutyl 4-methyl-4H-pyridine-1-carboxylate?
The IUPAC name of 4-ethenoxybutyl 4-methyl-4H-pyridine-1-carboxylate (CID 123916373) is 4-ethenoxybutyl 4-methyl-4H-pyridine-1-carboxylate.
What is the SMILES notation for 4-ethenoxybutyl 4-methyl-4H-pyridine-1-carboxylate?
The canonical SMILES for 4-ethenoxybutyl 4-methyl-4H-pyridine-1-carboxylate is C=COCCCCOC(=O)N1C=CC(C)C=C1.
What is the InChIKey of 4-ethenoxybutyl 4-methyl-4H-pyridine-1-carboxylate?
The InChIKey is PQGRIPSWZNZBSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3/c1-3-16-10-4-5-11-17-13(15)14-8-6-12(2)7-9-14/h3,6-9,12H,1,4-5,10-11H2,2H3.
What are the key properties of 4-ethenoxybutyl 4-methyl-4H-pyridine-1-carboxylate?
4-ethenoxybutyl 4-methyl-4H-pyridine-1-carboxylate has a molecular weight of 237.30 g/mol, XLogP of 3.04, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenoxybutyl 4-methyl-4H-pyridine-1-carboxylate is sourced from PubChem (CID 123916373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).