About 6-methyl-1H-quinolin-4-one;(6-methylquinolin-4-yl) trifluoromethanesulfonate
6-methyl-1H-quinolin-4-one;(6-methylquinolin-4-yl) trifluoromethanesulfonate (PubChem CID 123916450) has the molecular formula C21H17F3N2O4S
and a molecular weight of 450.44 g/mol. Its IUPAC name is 6-methyl-1H-quinolin-4-one;(6-methylquinolin-4-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 6-methyl-1H-quinolin-4-one;(6-methylquinolin-4-yl) trifluoromethanesulfonate |
| PubChem CID | 123916450 |
| Molecular Formula | C21H17F3N2O4S |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 6-methyl-1H-quinolin-4-one;(6-methylquinolin-4-yl) trifluoromethanesulfonate |
| SMILES | Cc1ccc2[nH]ccc(=O)c2c1.Cc1ccc2nccc(OS(=O)(=O)C(F)(F)F)c2c1 |
| InChI | InChI=1S/C11H8F3NO3S.C10H9NO/c1-7-2-3-9-8(6-7)10(4-5-15-9)18-19(16,17)11(12,13)14;1-7-2-3-9-8(6-7)10(12)4-5-11-9/h2-6H,1H3;2-6H,1H3,(H,11,12) |
| InChIKey | ZHJXGJAAJHPPHG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-1H-quinolin-4-one;(6-methylquinolin-4-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1H-quinolin-4-one;(6-methylquinolin-4-yl) trifluoromethanesulfonate?
The IUPAC name of 6-methyl-1H-quinolin-4-one;(6-methylquinolin-4-yl) trifluoromethanesulfonate (CID 123916450) is 6-methyl-1H-quinolin-4-one;(6-methylquinolin-4-yl) trifluoromethanesulfonate.
What is the SMILES notation for 6-methyl-1H-quinolin-4-one;(6-methylquinolin-4-yl) trifluoromethanesulfonate?
The canonical SMILES for 6-methyl-1H-quinolin-4-one;(6-methylquinolin-4-yl) trifluoromethanesulfonate is Cc1ccc2[nH]ccc(=O)c2c1.Cc1ccc2nccc(OS(=O)(=O)C(F)(F)F)c2c1.
What is the InChIKey of 6-methyl-1H-quinolin-4-one;(6-methylquinolin-4-yl) trifluoromethanesulfonate?
The InChIKey is ZHJXGJAAJHPPHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F3NO3S.C10H9NO/c1-7-2-3-9-8(6-7)10(4-5-15-9)18-19(16,17)11(12,13)14;1-7-2-3-9-8(6-7)10(12)4-5-11-9/h2-6H,1H3;2-6H,1H3,(H,11,12).
What are the key properties of 6-methyl-1H-quinolin-4-one;(6-methylquinolin-4-yl) trifluoromethanesulfonate?
6-methyl-1H-quinolin-4-one;(6-methylquinolin-4-yl) trifluoromethanesulfonate has a molecular weight of 450.44 g/mol, XLogP of 4.61, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1H-quinolin-4-one;(6-methylquinolin-4-yl) trifluoromethanesulfonate is sourced from PubChem (CID 123916450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).