C21H17F3N2O4S — CID 123916450
6-methyl-1H-quinolin-4-one;(6-methylquinolin-4-yl) trifluoromethanesulfonate (PubChem CID 123916450) has the molecular formula C21H17F3N2O4S and a molecular weight of 450.44 g/mol. Its IUPAC name is 6-methyl-1H-quinolin-4-one;(6-methylquinolin-4-yl) trifluoromethanesulfonate.
| Compound Name | 6-methyl-1H-quinolin-4-one;(6-methylquinolin-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 123916450 |
| Molecular Formula | C21H17F3N2O4S |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 6-methyl-1H-quinolin-4-one;(6-methylquinolin-4-yl) trifluoromethanesulfonate |
| SMILES | Cc1ccc2[nH]ccc(=O)c2c1.Cc1ccc2nccc(OS(=O)(=O)C(F)(F)F)c2c1 |
| InChI | InChI=1S/C11H8F3NO3S.C10H9NO/c1-7-2-3-9-8(6-7)10(4-5-15-9)18-19(16,17)11(12,13)14;1-7-2-3-9-8(6-7)10(12)4-5-11-9/h2-6H,1H3;2-6H,1H3,(H,11,12) |
| InChIKey | ZHJXGJAAJHPPHG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|