C11H14F3NO5S — CID 123916869
[3-hydroxy-3-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propyl] methanesulfonate (PubChem CID 123916869) has the molecular formula C11H14F3NO5S and a molecular weight of 329.30 g/mol. Its IUPAC name is [3-hydroxy-3-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propyl] methanesulfonate.
| Compound Name | [3-hydroxy-3-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propyl] methanesulfonate |
|---|---|
| PubChem CID | 123916869 |
| Molecular Formula | C11H14F3NO5S |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | [3-hydroxy-3-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]propyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCCC(O)c1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C11H14F3NO5S/c1-21(17,18)20-5-4-9(16)8-2-3-10(15-6-8)19-7-11(12,13)14/h2-3,6,9,16H,4-5,7H2,1H3 |
| InChIKey | PMVYBGYYIXCYON-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|