About 4-oxopyrido[1,2-a]pyrimidine-2-carboperoxoic acid
4-oxopyrido[1,2-a]pyrimidine-2-carboperoxoic acid (PubChem CID 123917274) has the molecular formula C9H6N2O4
and a molecular weight of 206.16 g/mol. Its IUPAC name is 4-oxopyrido[1,2-a]pyrimidine-2-carboperoxoic acid.
Molecular Properties
| Compound Name | 4-oxopyrido[1,2-a]pyrimidine-2-carboperoxoic acid |
| PubChem CID | 123917274 |
| Molecular Formula | C9H6N2O4 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 4-oxopyrido[1,2-a]pyrimidine-2-carboperoxoic acid |
| SMILES | O=C(OO)c1cc(=O)n2ccccc2n1 |
| InChI | InChI=1S/C9H6N2O4/c12-8-5-6(9(13)15-14)10-7-3-1-2-4-11(7)8/h1-5,14H |
| InChIKey | CUHRMSNGLHRYAY-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-oxopyrido[1,2-a]pyrimidine-2-carboperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxopyrido[1,2-a]pyrimidine-2-carboperoxoic acid?
The IUPAC name of 4-oxopyrido[1,2-a]pyrimidine-2-carboperoxoic acid (CID 123917274) is 4-oxopyrido[1,2-a]pyrimidine-2-carboperoxoic acid.
What is the SMILES notation for 4-oxopyrido[1,2-a]pyrimidine-2-carboperoxoic acid?
The canonical SMILES for 4-oxopyrido[1,2-a]pyrimidine-2-carboperoxoic acid is O=C(OO)c1cc(=O)n2ccccc2n1.
What is the InChIKey of 4-oxopyrido[1,2-a]pyrimidine-2-carboperoxoic acid?
The InChIKey is CUHRMSNGLHRYAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O4/c12-8-5-6(9(13)15-14)10-7-3-1-2-4-11(7)8/h1-5,14H.
What are the key properties of 4-oxopyrido[1,2-a]pyrimidine-2-carboperoxoic acid?
4-oxopyrido[1,2-a]pyrimidine-2-carboperoxoic acid has a molecular weight of 206.16 g/mol, XLogP of 0.32, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxopyrido[1,2-a]pyrimidine-2-carboperoxoic acid is sourced from PubChem (CID 123917274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).