C22H19Cl2N5O — CID 123917432
3-[2-[6-chloro-2-(2-chlorophenyl)-1H-imidazo[4,5-b]pyridin-7-yl]-2-iminoethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 123917432) has the molecular formula C22H19Cl2N5O and a molecular weight of 440.33 g/mol. Its IUPAC name is 3-[2-[6-chloro-2-(2-chlorophenyl)-1H-imidazo[4,5-b]pyridin-7-yl]-2-iminoethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | 3-[2-[6-chloro-2-(2-chlorophenyl)-1H-imidazo[4,5-b]pyridin-7-yl]-2-iminoethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 123917432 |
| Molecular Formula | C22H19Cl2N5O |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 3-[2-[6-chloro-2-(2-chlorophenyl)-1H-imidazo[4,5-b]pyridin-7-yl]-2-iminoethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | [H]/N=C(\CC1C2C=CC(C2)C1C(N)=O)c1c(Cl)cnc2nc(-c3ccccc3Cl)[nH]c12 |
| InChI | InChI=1S/C22H19Cl2N5O/c23-14-4-2-1-3-12(14)21-28-19-18(15(24)9-27-22(19)29-21)16(25)8-13-10-5-6-11(7-10)17(13)20(26)30/h1-6,9-11,13,17,25H,7-8H2,(H2,26,30)(H,27,28,29)/b25-16+ |
| InChIKey | OBDDZVPMRUPNPN-PCLIKHOPSA-N |
| XLogP | 4.61 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|