About (4Z)-N,4-dimethylnona-4,7-dien-3-imine
(4Z)-N,4-dimethylnona-4,7-dien-3-imine (PubChem CID 123918033) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is (4Z)-N,4-dimethylnona-4,7-dien-3-imine.
Molecular Properties
| Compound Name | (4Z)-N,4-dimethylnona-4,7-dien-3-imine |
| PubChem CID | 123918033 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (4Z)-N,4-dimethylnona-4,7-dien-3-imine |
| SMILES | CC=CC/C=C(C)\C(CC)=N\C |
| InChI | InChI=1S/C11H19N/c1-5-7-8-9-10(3)11(6-2)12-4/h5,7,9H,6,8H2,1-4H3/b7-5?,10-9-,12-11+ |
| InChIKey | OPNMYINHIJTUKA-VEGJCCJASA-N |
| XLogP | 3.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-N,4-dimethylnona-4,7-dien-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-N,4-dimethylnona-4,7-dien-3-imine?
The IUPAC name of (4Z)-N,4-dimethylnona-4,7-dien-3-imine (CID 123918033) is (4Z)-N,4-dimethylnona-4,7-dien-3-imine.
What is the SMILES notation for (4Z)-N,4-dimethylnona-4,7-dien-3-imine?
The canonical SMILES for (4Z)-N,4-dimethylnona-4,7-dien-3-imine is CC=CC/C=C(C)\C(CC)=N\C.
What is the InChIKey of (4Z)-N,4-dimethylnona-4,7-dien-3-imine?
The InChIKey is OPNMYINHIJTUKA-VEGJCCJASA-N. The full InChI is InChI=1S/C11H19N/c1-5-7-8-9-10(3)11(6-2)12-4/h5,7,9H,6,8H2,1-4H3/b7-5?,10-9-,12-11+.
What are the key properties of (4Z)-N,4-dimethylnona-4,7-dien-3-imine?
(4Z)-N,4-dimethylnona-4,7-dien-3-imine has a molecular weight of 165.28 g/mol, XLogP of 3.38, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-N,4-dimethylnona-4,7-dien-3-imine is sourced from PubChem (CID 123918033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).