About 5-(furan-2-ylmethyl)-1,2-oxazole
5-(furan-2-ylmethyl)-1,2-oxazole (PubChem CID 123918536) has the molecular formula C8H7NO2
and a molecular weight of 149.15 g/mol. Its IUPAC name is 5-(furan-2-ylmethyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(furan-2-ylmethyl)-1,2-oxazole |
| PubChem CID | 123918536 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 5-(furan-2-ylmethyl)-1,2-oxazole |
| SMILES | c1coc(Cc2ccno2)c1 |
| InChI | InChI=1S/C8H7NO2/c1-2-7(10-5-1)6-8-3-4-9-11-8/h1-5H,6H2 |
| InChIKey | HHXRUTQLQXAUCG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(furan-2-ylmethyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(furan-2-ylmethyl)-1,2-oxazole?
The IUPAC name of 5-(furan-2-ylmethyl)-1,2-oxazole (CID 123918536) is 5-(furan-2-ylmethyl)-1,2-oxazole.
What is the SMILES notation for 5-(furan-2-ylmethyl)-1,2-oxazole?
The canonical SMILES for 5-(furan-2-ylmethyl)-1,2-oxazole is c1coc(Cc2ccno2)c1.
What is the InChIKey of 5-(furan-2-ylmethyl)-1,2-oxazole?
The InChIKey is HHXRUTQLQXAUCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2/c1-2-7(10-5-1)6-8-3-4-9-11-8/h1-5H,6H2.
What are the key properties of 5-(furan-2-ylmethyl)-1,2-oxazole?
5-(furan-2-ylmethyl)-1,2-oxazole has a molecular weight of 149.15 g/mol, XLogP of 1.86, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(furan-2-ylmethyl)-1,2-oxazole is sourced from PubChem (CID 123918536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).