About [9-(ethoxymethyl)-3,7-dimethyl-10-oxoundeca-2,6-dienyl] acetate
[9-(ethoxymethyl)-3,7-dimethyl-10-oxoundeca-2,6-dienyl] acetate (PubChem CID 123918898) has the molecular formula C18H30O4
and a molecular weight of 310.43 g/mol. Its IUPAC name is [9-(ethoxymethyl)-3,7-dimethyl-10-oxoundeca-2,6-dienyl] acetate.
Molecular Properties
| Compound Name | [9-(ethoxymethyl)-3,7-dimethyl-10-oxoundeca-2,6-dienyl] acetate |
| PubChem CID | 123918898 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | [9-(ethoxymethyl)-3,7-dimethyl-10-oxoundeca-2,6-dienyl] acetate |
| SMILES | CCOCC(CC(C)=CCCC(C)=CCOC(C)=O)C(C)=O |
| InChI | InChI=1S/C18H30O4/c1-6-21-13-18(16(4)19)12-15(3)9-7-8-14(2)10-11-22-17(5)20/h9-10,18H,6-8,11-13H2,1-5H3 |
| InChIKey | ZVAWNRKGSSRONF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [9-(ethoxymethyl)-3,7-dimethyl-10-oxoundeca-2,6-dienyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [9-(ethoxymethyl)-3,7-dimethyl-10-oxoundeca-2,6-dienyl] acetate?
The IUPAC name of [9-(ethoxymethyl)-3,7-dimethyl-10-oxoundeca-2,6-dienyl] acetate (CID 123918898) is [9-(ethoxymethyl)-3,7-dimethyl-10-oxoundeca-2,6-dienyl] acetate.
What is the SMILES notation for [9-(ethoxymethyl)-3,7-dimethyl-10-oxoundeca-2,6-dienyl] acetate?
The canonical SMILES for [9-(ethoxymethyl)-3,7-dimethyl-10-oxoundeca-2,6-dienyl] acetate is CCOCC(CC(C)=CCCC(C)=CCOC(C)=O)C(C)=O.
What is the InChIKey of [9-(ethoxymethyl)-3,7-dimethyl-10-oxoundeca-2,6-dienyl] acetate?
The InChIKey is ZVAWNRKGSSRONF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O4/c1-6-21-13-18(16(4)19)12-15(3)9-7-8-14(2)10-11-22-17(5)20/h9-10,18H,6-8,11-13H2,1-5H3.
What are the key properties of [9-(ethoxymethyl)-3,7-dimethyl-10-oxoundeca-2,6-dienyl] acetate?
[9-(ethoxymethyl)-3,7-dimethyl-10-oxoundeca-2,6-dienyl] acetate has a molecular weight of 310.43 g/mol, XLogP of 3.85, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [9-(ethoxymethyl)-3,7-dimethyl-10-oxoundeca-2,6-dienyl] acetate is sourced from PubChem (CID 123918898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).