C19H38 — CID 123919039
1,1,2,2,3,4,5,5,6,6,7-undecamethylcyclooctane (PubChem CID 123919039) has the molecular formula C19H38 and a molecular weight of 266.51 g/mol. Its IUPAC name is 1,1,2,2,3,4,5,5,6,6,7-undecamethylcyclooctane.
| Compound Name | 1,1,2,2,3,4,5,5,6,6,7-undecamethylcyclooctane |
|---|---|
| PubChem CID | 123919039 |
| Molecular Formula | C19H38 |
| Molecular Weight | 266.51 g/mol |
| Exact Mass | 266.30 |
| IUPAC Name | 1,1,2,2,3,4,5,5,6,6,7-undecamethylcyclooctane |
| SMILES | CC1C(C)C(C)(C)C(C)(C)C(C)CC(C)(C)C1(C)C |
| InChI | InChI=1S/C19H38/c1-13-12-16(4,5)18(8,9)14(2)15(3)19(10,11)17(13,6)7/h13-15H,12H2,1-11H3 |
| InChIKey | GGLFTSZPCJLZTE-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.51 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |