C18H34FN — CID 123919134
N-(5-fluoro-4-methyl-3-methylidenepentan-2-yl)-3,3,4,5-tetramethylhept-6-en-1-amine (PubChem CID 123919134) has the molecular formula C18H34FN and a molecular weight of 283.48 g/mol. Its IUPAC name is N-(5-fluoro-4-methyl-3-methylidenepentan-2-yl)-3,3,4,5-tetramethylhept-6-en-1-amine.
| Compound Name | N-(5-fluoro-4-methyl-3-methylidenepentan-2-yl)-3,3,4,5-tetramethylhept-6-en-1-amine |
|---|---|
| PubChem CID | 123919134 |
| Molecular Formula | C18H34FN |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.27 |
| IUPAC Name | N-(5-fluoro-4-methyl-3-methylidenepentan-2-yl)-3,3,4,5-tetramethylhept-6-en-1-amine |
| SMILES | C=CC(C)C(C)C(C)(C)CCNC(C)C(=C)C(C)CF |
| InChI | InChI=1S/C18H34FN/c1-9-13(2)16(5)18(7,8)10-11-20-17(6)15(4)14(3)12-19/h9,13-14,16-17,20H,1,4,10-12H2,2-3,5-8H3 |
| InChIKey | JBUHVIGHPMVXRX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|