C23H26ClN5 — CID 123919541
1-(4-tert-butylphenyl)-N-[1-[1-[(2-chloro-4-pyridinyl)methyl]-5-methyl-1,2,4-triazol-3-yl]ethenyl]ethanimine (PubChem CID 123919541) has the molecular formula C23H26ClN5 and a molecular weight of 407.95 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-N-[1-[1-[(2-chloro-4-pyridinyl)methyl]-5-methyl-1,2,4-triazol-3-yl]ethenyl]ethanimine.
| Compound Name | 1-(4-tert-butylphenyl)-N-[1-[1-[(2-chloro-4-pyridinyl)methyl]-5-methyl-1,2,4-triazol-3-yl]ethenyl]ethanimine |
|---|---|
| PubChem CID | 123919541 |
| Molecular Formula | C23H26ClN5 |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 1-(4-tert-butylphenyl)-N-[1-[1-[(2-chloro-4-pyridinyl)methyl]-5-methyl-1,2,4-triazol-3-yl]ethenyl]ethanimine |
| SMILES | C=C(/N=C(\C)c1ccc(C(C)(C)C)cc1)c1nc(C)n(Cc2ccnc(Cl)c2)n1 |
| InChI | InChI=1S/C23H26ClN5/c1-15(19-7-9-20(10-8-19)23(4,5)6)26-16(2)22-27-17(3)29(28-22)14-18-11-12-25-21(24)13-18/h7-13H,2,14H2,1,3-6H3/b26-15+ |
| InChIKey | QAZVADVWHSKCOG-CVKSISIWSA-N |
| XLogP | 5.46 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|