C14H20BF3N2O2 — CID 123919722
3-(trifluoromethyl)-5-(4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (PubChem CID 123919722) has the molecular formula C14H20BF3N2O2 and a molecular weight of 316.13 g/mol. Its IUPAC name is 3-(trifluoromethyl)-5-(4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
| Compound Name | 3-(trifluoromethyl)-5-(4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 123919722 |
| Molecular Formula | C14H20BF3N2O2 |
| Molecular Weight | 316.13 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 3-(trifluoromethyl)-5-(4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| SMILES | CC(C)C1(C)OB(c2cnc(N)c(C(F)(F)F)c2)OC1(C)C |
| InChI | InChI=1S/C14H20BF3N2O2/c1-8(2)13(5)12(3,4)21-15(22-13)9-6-10(14(16,17)18)11(19)20-7-9/h6-8H,1-5H3,(H2,19,20) |
| InChIKey | QADNICOPONYGOT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.13 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|