C9H3Cl2F7OS — CID 123919895
1,3-dichloro-5-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)benzene (PubChem CID 123919895) has the molecular formula C9H3Cl2F7OS and a molecular weight of 363.08 g/mol. Its IUPAC name is 1,3-dichloro-5-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)benzene.
| Compound Name | 1,3-dichloro-5-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)benzene |
|---|---|
| PubChem CID | 123919895 |
| Molecular Formula | C9H3Cl2F7OS |
| Molecular Weight | 363.08 g/mol |
| Exact Mass | 361.92 |
| IUPAC Name | 1,3-dichloro-5-(1,1,2,2,3,3,3-heptafluoropropylsulfinyl)benzene |
| SMILES | O=S(c1cc(Cl)cc(Cl)c1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H3Cl2F7OS/c10-4-1-5(11)3-6(2-4)20(19)9(17,18)7(12,13)8(14,15)16/h1-3H |
| InChIKey | MMWWYSJJDZOJLQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.08 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|