About 2-azido-6-isocyano-3,4-dihydro-2H-naphthalen-1-one
2-azido-6-isocyano-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 123919970) has the molecular formula C11H8N4O
and a molecular weight of 212.21 g/mol. Its IUPAC name is 2-azido-6-isocyano-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 2-azido-6-isocyano-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 123919970 |
| Molecular Formula | C11H8N4O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-azido-6-isocyano-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | [C-]#[N+]c1ccc2c(c1)CCC(N=[N+]=[N-])C2=O |
| InChI | InChI=1S/C11H8N4O/c1-13-8-3-4-9-7(6-8)2-5-10(11(9)16)14-15-12/h3-4,6,10H,2,5H2 |
| InChIKey | ZNGIRQQJRNBQSR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-6-isocyano-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-6-isocyano-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of 2-azido-6-isocyano-3,4-dihydro-2H-naphthalen-1-one (CID 123919970) is 2-azido-6-isocyano-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 2-azido-6-isocyano-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 2-azido-6-isocyano-3,4-dihydro-2H-naphthalen-1-one is [C-]#[N+]c1ccc2c(c1)CCC(N=[N+]=[N-])C2=O.
What is the InChIKey of 2-azido-6-isocyano-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is ZNGIRQQJRNBQSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4O/c1-13-8-3-4-9-7(6-8)2-5-10(11(9)16)14-15-12/h3-4,6,10H,2,5H2.
What are the key properties of 2-azido-6-isocyano-3,4-dihydro-2H-naphthalen-1-one?
2-azido-6-isocyano-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 212.21 g/mol, XLogP of 3.05, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-6-isocyano-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 123919970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).