C25H33FN+ — CID 123920160
4-butyl-14-ethenyl-8,9-diethyl-9-(fluoromethyl)-8-methyl-14-azoniatricyclo[8.3.1.02,7]tetradeca-1(14),2(7),3,5,10,12-hexaene (PubChem CID 123920160) has the molecular formula C25H33FN+ and a molecular weight of 366.54 g/mol. Its IUPAC name is 4-butyl-14-ethenyl-8,9-diethyl-9-(fluoromethyl)-8-methyl-14-azoniatricyclo[8.3.1.02,7]tetradeca-1(14),2(7),3,5,10,12-hexaene.
| Compound Name | 4-butyl-14-ethenyl-8,9-diethyl-9-(fluoromethyl)-8-methyl-14-azoniatricyclo[8.3.1.02,7]tetradeca-1(14),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 123920160 |
| Molecular Formula | C25H33FN+ |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | 4-butyl-14-ethenyl-8,9-diethyl-9-(fluoromethyl)-8-methyl-14-azoniatricyclo[8.3.1.02,7]tetradeca-1(14),2(7),3,5,10,12-hexaene |
| SMILES | C=C[n+]1c2cccc1C(CC)(CF)C(C)(CC)c1ccc(CCCC)cc1-2 |
| InChI | InChI=1S/C25H33FN/c1-6-10-12-19-15-16-21-20(17-19)22-13-11-14-23(27(22)9-4)25(8-3,18-26)24(21,5)7-2/h9,11,13-17H,4,6-8,10,12,18H2,1-3,5H3/q+1 |
| InChIKey | DMCNYLLTQCHNMF-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|