C29H37N3O8S — CID 123920737
5-acetamido-2-(3-ethylsulfanylpropoxy)-4-hydroxy-6-[1-hydroxy-3-[(4-phenylbenzoyl)amino]propyl]-N-oxooxane-2-carboxamide (PubChem CID 123920737) has the molecular formula C29H37N3O8S and a molecular weight of 587.70 g/mol. Its IUPAC name is 5-acetamido-2-(3-ethylsulfanylpropoxy)-4-hydroxy-6-[1-hydroxy-3-[(4-phenylbenzoyl)amino]propyl]-N-oxooxane-2-carboxamide.
| Compound Name | 5-acetamido-2-(3-ethylsulfanylpropoxy)-4-hydroxy-6-[1-hydroxy-3-[(4-phenylbenzoyl)amino]propyl]-N-oxooxane-2-carboxamide |
|---|---|
| PubChem CID | 123920737 |
| Molecular Formula | C29H37N3O8S |
| Molecular Weight | 587.70 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | 5-acetamido-2-(3-ethylsulfanylpropoxy)-4-hydroxy-6-[1-hydroxy-3-[(4-phenylbenzoyl)amino]propyl]-N-oxooxane-2-carboxamide |
| SMILES | CCSCCCOC1(C(=O)N=O)CC(O)C(NC(C)=O)C(C(O)CCNC(=O)c2ccc(-c3ccccc3)cc2)O1 |
| InChI | InChI=1S/C29H37N3O8S/c1-3-41-17-7-16-39-29(28(37)32-38)18-24(35)25(31-19(2)33)26(40-29)23(34)14-15-30-27(36)22-12-10-21(11-13-22)20-8-5-4-6-9-20/h4-6,8-13,23-26,34-35H,3,7,14-18H2,1-2H3,(H,30,36)(H,31,33) |
| InChIKey | WNJKDOOSTRKONC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 163.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.70 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|