About N-(2-butan-2-ylcyclohexyl)-N-cyclohexyl-N'-hexan-2-ylmethanimidamide
N-(2-butan-2-ylcyclohexyl)-N-cyclohexyl-N'-hexan-2-ylmethanimidamide (PubChem CID 123921304) has the molecular formula C23H44N2
and a molecular weight of 348.62 g/mol. Its IUPAC name is N-(2-butan-2-ylcyclohexyl)-N-cyclohexyl-N'-hexan-2-ylmethanimidamide.
Molecular Properties
| Compound Name | N-(2-butan-2-ylcyclohexyl)-N-cyclohexyl-N'-hexan-2-ylmethanimidamide |
| PubChem CID | 123921304 |
| Molecular Formula | C23H44N2 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 348.35 |
| IUPAC Name | N-(2-butan-2-ylcyclohexyl)-N-cyclohexyl-N'-hexan-2-ylmethanimidamide |
| SMILES | CCCCC(C)/N=C/N(C1CCCCC1)C1CCCCC1C(C)CC |
| InChI | InChI=1S/C23H44N2/c1-5-7-13-20(4)24-18-25(21-14-9-8-10-15-21)23-17-12-11-16-22(23)19(3)6-2/h18-23H,5-17H2,1-4H3/b24-18+ |
| InChIKey | FXZUNYDAYXCYFW-HKOYGPOVSA-N |
| XLogP | 6.83 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(2-butan-2-ylcyclohexyl)-N-cyclohexyl-N'-hexan-2-ylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-butan-2-ylcyclohexyl)-N-cyclohexyl-N'-hexan-2-ylmethanimidamide?
The IUPAC name of N-(2-butan-2-ylcyclohexyl)-N-cyclohexyl-N'-hexan-2-ylmethanimidamide (CID 123921304) is N-(2-butan-2-ylcyclohexyl)-N-cyclohexyl-N'-hexan-2-ylmethanimidamide.
What is the SMILES notation for N-(2-butan-2-ylcyclohexyl)-N-cyclohexyl-N'-hexan-2-ylmethanimidamide?
The canonical SMILES for N-(2-butan-2-ylcyclohexyl)-N-cyclohexyl-N'-hexan-2-ylmethanimidamide is CCCCC(C)/N=C/N(C1CCCCC1)C1CCCCC1C(C)CC.
What is the InChIKey of N-(2-butan-2-ylcyclohexyl)-N-cyclohexyl-N'-hexan-2-ylmethanimidamide?
The InChIKey is FXZUNYDAYXCYFW-HKOYGPOVSA-N. The full InChI is InChI=1S/C23H44N2/c1-5-7-13-20(4)24-18-25(21-14-9-8-10-15-21)23-17-12-11-16-22(23)19(3)6-2/h18-23H,5-17H2,1-4H3/b24-18+.
What are the key properties of N-(2-butan-2-ylcyclohexyl)-N-cyclohexyl-N'-hexan-2-ylmethanimidamide?
N-(2-butan-2-ylcyclohexyl)-N-cyclohexyl-N'-hexan-2-ylmethanimidamide has a molecular weight of 348.62 g/mol, XLogP of 6.83, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-butan-2-ylcyclohexyl)-N-cyclohexyl-N'-hexan-2-ylmethanimidamide is sourced from PubChem (CID 123921304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).