C9H4ClF5O — CID 123921310
3-chloro-5-(1,2,3,3,3-pentafluoroprop-1-enyl)phenol (PubChem CID 123921310) has the molecular formula C9H4ClF5O and a molecular weight of 258.57 g/mol. Its IUPAC name is 3-chloro-5-(1,2,3,3,3-pentafluoroprop-1-enyl)phenol.
| Compound Name | 3-chloro-5-(1,2,3,3,3-pentafluoroprop-1-enyl)phenol |
|---|---|
| PubChem CID | 123921310 |
| Molecular Formula | C9H4ClF5O |
| Molecular Weight | 258.57 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 3-chloro-5-(1,2,3,3,3-pentafluoroprop-1-enyl)phenol |
| SMILES | Oc1cc(Cl)cc(C(F)=C(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C9H4ClF5O/c10-5-1-4(2-6(16)3-5)7(11)8(12)9(13,14)15/h1-3,16H |
| InChIKey | PDQCNLOSIZABRN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |