C21H30N2O — CID 123921368
1-[4-[3,5-dimethylocta-1,3,5,7-tetraen-2-yl(methyl)amino]piperidin-1-yl]-2-methylidenebut-3-en-1-one (PubChem CID 123921368) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is 1-[4-[3,5-dimethylocta-1,3,5,7-tetraen-2-yl(methyl)amino]piperidin-1-yl]-2-methylidenebut-3-en-1-one.
| Compound Name | 1-[4-[3,5-dimethylocta-1,3,5,7-tetraen-2-yl(methyl)amino]piperidin-1-yl]-2-methylidenebut-3-en-1-one |
|---|---|
| PubChem CID | 123921368 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | 1-[4-[3,5-dimethylocta-1,3,5,7-tetraen-2-yl(methyl)amino]piperidin-1-yl]-2-methylidenebut-3-en-1-one |
| SMILES | C=CC=C(C)C=C(C)C(=C)N(C)C1CCN(C(=O)C(=C)C=C)CC1 |
| InChI | InChI=1S/C21H30N2O/c1-8-10-16(3)15-18(5)19(6)22(7)20-11-13-23(14-12-20)21(24)17(4)9-2/h8-10,15,20H,1-2,4,6,11-14H2,3,5,7H3 |
| InChIKey | YOJXSYMYCGQQFG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|