About 5-chloro-3-methyl-2,3-dihydropyridine-4-carbaldehyde
5-chloro-3-methyl-2,3-dihydropyridine-4-carbaldehyde (PubChem CID 123922086) has the molecular formula C7H8ClNO
and a molecular weight of 157.60 g/mol. Its IUPAC name is 5-chloro-3-methyl-2,3-dihydropyridine-4-carbaldehyde.
Molecular Properties
| Compound Name | 5-chloro-3-methyl-2,3-dihydropyridine-4-carbaldehyde |
| PubChem CID | 123922086 |
| Molecular Formula | C7H8ClNO |
| Molecular Weight | 157.60 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | 5-chloro-3-methyl-2,3-dihydropyridine-4-carbaldehyde |
| SMILES | CC1CN=CC(Cl)=C1C=O |
| InChI | InChI=1S/C7H8ClNO/c1-5-2-9-3-7(8)6(5)4-10/h3-5H,2H2,1H3 |
| InChIKey | IKMZLPUHGYERJY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.60 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-3-methyl-2,3-dihydropyridine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-methyl-2,3-dihydropyridine-4-carbaldehyde?
The IUPAC name of 5-chloro-3-methyl-2,3-dihydropyridine-4-carbaldehyde (CID 123922086) is 5-chloro-3-methyl-2,3-dihydropyridine-4-carbaldehyde.
What is the SMILES notation for 5-chloro-3-methyl-2,3-dihydropyridine-4-carbaldehyde?
The canonical SMILES for 5-chloro-3-methyl-2,3-dihydropyridine-4-carbaldehyde is CC1CN=CC(Cl)=C1C=O.
What is the InChIKey of 5-chloro-3-methyl-2,3-dihydropyridine-4-carbaldehyde?
The InChIKey is IKMZLPUHGYERJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClNO/c1-5-2-9-3-7(8)6(5)4-10/h3-5H,2H2,1H3.
What are the key properties of 5-chloro-3-methyl-2,3-dihydropyridine-4-carbaldehyde?
5-chloro-3-methyl-2,3-dihydropyridine-4-carbaldehyde has a molecular weight of 157.60 g/mol, XLogP of 1.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-methyl-2,3-dihydropyridine-4-carbaldehyde is sourced from PubChem (CID 123922086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).