About (5E)-8-methyl-3-[(E)-4-oxopent-1-enyl]iminonona-5,8-diene-2,4-dione
(5E)-8-methyl-3-[(E)-4-oxopent-1-enyl]iminonona-5,8-diene-2,4-dione (PubChem CID 123922416) has the molecular formula C15H19NO3
and a molecular weight of 261.32 g/mol. Its IUPAC name is (5E)-8-methyl-3-[(E)-4-oxopent-1-enyl]iminonona-5,8-diene-2,4-dione.
Molecular Properties
| Compound Name | (5E)-8-methyl-3-[(E)-4-oxopent-1-enyl]iminonona-5,8-diene-2,4-dione |
| PubChem CID | 123922416 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (5E)-8-methyl-3-[(E)-4-oxopent-1-enyl]iminonona-5,8-diene-2,4-dione |
| SMILES | C=C(C)C/C=C/C(=O)/C(=N/C=C/CC(C)=O)C(C)=O |
| InChI | InChI=1S/C15H19NO3/c1-11(2)7-5-9-14(19)15(13(4)18)16-10-6-8-12(3)17/h5-6,9-10H,1,7-8H2,2-4H3/b9-5+,10-6+,16-15+ |
| InChIKey | ZAEZBFSNGHGZJS-CRARHVCKSA-N |
| XLogP | 2.60 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5E)-8-methyl-3-[(E)-4-oxopent-1-enyl]iminonona-5,8-diene-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-8-methyl-3-[(E)-4-oxopent-1-enyl]iminonona-5,8-diene-2,4-dione?
The IUPAC name of (5E)-8-methyl-3-[(E)-4-oxopent-1-enyl]iminonona-5,8-diene-2,4-dione (CID 123922416) is (5E)-8-methyl-3-[(E)-4-oxopent-1-enyl]iminonona-5,8-diene-2,4-dione.
What is the SMILES notation for (5E)-8-methyl-3-[(E)-4-oxopent-1-enyl]iminonona-5,8-diene-2,4-dione?
The canonical SMILES for (5E)-8-methyl-3-[(E)-4-oxopent-1-enyl]iminonona-5,8-diene-2,4-dione is C=C(C)C/C=C/C(=O)/C(=N/C=C/CC(C)=O)C(C)=O.
What is the InChIKey of (5E)-8-methyl-3-[(E)-4-oxopent-1-enyl]iminonona-5,8-diene-2,4-dione?
The InChIKey is ZAEZBFSNGHGZJS-CRARHVCKSA-N. The full InChI is InChI=1S/C15H19NO3/c1-11(2)7-5-9-14(19)15(13(4)18)16-10-6-8-12(3)17/h5-6,9-10H,1,7-8H2,2-4H3/b9-5+,10-6+,16-15+.
What are the key properties of (5E)-8-methyl-3-[(E)-4-oxopent-1-enyl]iminonona-5,8-diene-2,4-dione?
(5E)-8-methyl-3-[(E)-4-oxopent-1-enyl]iminonona-5,8-diene-2,4-dione has a molecular weight of 261.32 g/mol, XLogP of 2.60, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-8-methyl-3-[(E)-4-oxopent-1-enyl]iminonona-5,8-diene-2,4-dione is sourced from PubChem (CID 123922416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).