C8H12N2S2 — CID 123922711
2-propan-2-yl-5-sulfanyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole (PubChem CID 123922711) has the molecular formula C8H12N2S2 and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-propan-2-yl-5-sulfanyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole.
| Compound Name | 2-propan-2-yl-5-sulfanyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole |
|---|---|
| PubChem CID | 123922711 |
| Molecular Formula | C8H12N2S2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 2-propan-2-yl-5-sulfanyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole |
| SMILES | CC(C)c1nc2c(s1)CN(S)C2 |
| InChI | InChI=1S/C8H12N2S2/c1-5(2)8-9-6-3-10(11)4-7(6)12-8/h5,11H,3-4H2,1-2H3 |
| InChIKey | NMOMZVIQJKORAU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 16.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|