About 2-methylideneoxan-4-one;2-methylpropane
2-methylideneoxan-4-one;2-methylpropane (PubChem CID 123922746) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is 2-methylideneoxan-4-one;2-methylpropane.
Molecular Properties
| Compound Name | 2-methylideneoxan-4-one;2-methylpropane |
| PubChem CID | 123922746 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 2-methylideneoxan-4-one;2-methylpropane |
| SMILES | C=C1CC(=O)CCO1.CC(C)C |
| InChI | InChI=1S/C6H8O2.C4H10/c1-5-4-6(7)2-3-8-5;1-4(2)3/h1-4H2;4H,1-3H3 |
| InChIKey | IBZPUCOBVJXODK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylideneoxan-4-one;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylideneoxan-4-one;2-methylpropane?
The IUPAC name of 2-methylideneoxan-4-one;2-methylpropane (CID 123922746) is 2-methylideneoxan-4-one;2-methylpropane.
What is the SMILES notation for 2-methylideneoxan-4-one;2-methylpropane?
The canonical SMILES for 2-methylideneoxan-4-one;2-methylpropane is C=C1CC(=O)CCO1.CC(C)C.
What is the InChIKey of 2-methylideneoxan-4-one;2-methylpropane?
The InChIKey is IBZPUCOBVJXODK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2.C4H10/c1-5-4-6(7)2-3-8-5;1-4(2)3/h1-4H2;4H,1-3H3.
What are the key properties of 2-methylideneoxan-4-one;2-methylpropane?
2-methylideneoxan-4-one;2-methylpropane has a molecular weight of 170.25 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylideneoxan-4-one;2-methylpropane is sourced from PubChem (CID 123922746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).