About 6-(1,1-difluoroethyl)-5-ethyl-4-fluoro-2-methyl-2,3-dihydropyridine
6-(1,1-difluoroethyl)-5-ethyl-4-fluoro-2-methyl-2,3-dihydropyridine (PubChem CID 123923241) has the molecular formula C10H14F3N
and a molecular weight of 205.22 g/mol. Its IUPAC name is 6-(1,1-difluoroethyl)-5-ethyl-4-fluoro-2-methyl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 6-(1,1-difluoroethyl)-5-ethyl-4-fluoro-2-methyl-2,3-dihydropyridine |
| PubChem CID | 123923241 |
| Molecular Formula | C10H14F3N |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 6-(1,1-difluoroethyl)-5-ethyl-4-fluoro-2-methyl-2,3-dihydropyridine |
| SMILES | CCC1=C(F)CC(C)N=C1C(C)(F)F |
| InChI | InChI=1S/C10H14F3N/c1-4-7-8(11)5-6(2)14-9(7)10(3,12)13/h6H,4-5H2,1-3H3 |
| InChIKey | USXXODUDNITOJI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(1,1-difluoroethyl)-5-ethyl-4-fluoro-2-methyl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,1-difluoroethyl)-5-ethyl-4-fluoro-2-methyl-2,3-dihydropyridine?
The IUPAC name of 6-(1,1-difluoroethyl)-5-ethyl-4-fluoro-2-methyl-2,3-dihydropyridine (CID 123923241) is 6-(1,1-difluoroethyl)-5-ethyl-4-fluoro-2-methyl-2,3-dihydropyridine.
What is the SMILES notation for 6-(1,1-difluoroethyl)-5-ethyl-4-fluoro-2-methyl-2,3-dihydropyridine?
The canonical SMILES for 6-(1,1-difluoroethyl)-5-ethyl-4-fluoro-2-methyl-2,3-dihydropyridine is CCC1=C(F)CC(C)N=C1C(C)(F)F.
What is the InChIKey of 6-(1,1-difluoroethyl)-5-ethyl-4-fluoro-2-methyl-2,3-dihydropyridine?
The InChIKey is USXXODUDNITOJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3N/c1-4-7-8(11)5-6(2)14-9(7)10(3,12)13/h6H,4-5H2,1-3H3.
What are the key properties of 6-(1,1-difluoroethyl)-5-ethyl-4-fluoro-2-methyl-2,3-dihydropyridine?
6-(1,1-difluoroethyl)-5-ethyl-4-fluoro-2-methyl-2,3-dihydropyridine has a molecular weight of 205.22 g/mol, XLogP of 3.51, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,1-difluoroethyl)-5-ethyl-4-fluoro-2-methyl-2,3-dihydropyridine is sourced from PubChem (CID 123923241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).