C13H25N3O7S2 — CID 123923495
S-[2-[[3-(hydroxyamino)oxy-2,2-dimethylpropanoyl]amino]-2-methylsulfanylethyl] 2,2-dimethyl-3-nitrooxypropanethioate (PubChem CID 123923495) has the molecular formula C13H25N3O7S2 and a molecular weight of 399.49 g/mol. Its IUPAC name is S-[2-[[3-(hydroxyamino)oxy-2,2-dimethylpropanoyl]amino]-2-methylsulfanylethyl] 2,2-dimethyl-3-nitrooxypropanethioate.
| Compound Name | S-[2-[[3-(hydroxyamino)oxy-2,2-dimethylpropanoyl]amino]-2-methylsulfanylethyl] 2,2-dimethyl-3-nitrooxypropanethioate |
|---|---|
| PubChem CID | 123923495 |
| Molecular Formula | C13H25N3O7S2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | S-[2-[[3-(hydroxyamino)oxy-2,2-dimethylpropanoyl]amino]-2-methylsulfanylethyl] 2,2-dimethyl-3-nitrooxypropanethioate |
| SMILES | CSC(CSC(=O)C(C)(C)CO[N+](=O)[O-])NC(=O)C(C)(C)CONO |
| InChI | InChI=1S/C13H25N3O7S2/c1-12(2,7-22-15-19)10(17)14-9(24-5)6-25-11(18)13(3,4)8-23-16(20)21/h9,15,19H,6-8H2,1-5H3,(H,14,17) |
| InChIKey | WZAPPSNMSHFCNH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|