C60H48N4 — CID 123923571
N-[1-[3-(4-carbazol-9-ylphenyl)-5-(2,6-diphenylpyrimidin-4-yl)phenyl]-3-phenylprop-1-enyl]-2-methyl-1-phenylbutan-1-imine (PubChem CID 123923571) has the molecular formula C60H48N4 and a molecular weight of 825.07 g/mol. Its IUPAC name is N-[1-[3-(4-carbazol-9-ylphenyl)-5-(2,6-diphenylpyrimidin-4-yl)phenyl]-3-phenylprop-1-enyl]-2-methyl-1-phenylbutan-1-imine.
| Compound Name | N-[1-[3-(4-carbazol-9-ylphenyl)-5-(2,6-diphenylpyrimidin-4-yl)phenyl]-3-phenylprop-1-enyl]-2-methyl-1-phenylbutan-1-imine |
|---|---|
| PubChem CID | 123923571 |
| Molecular Formula | C60H48N4 |
| Molecular Weight | 825.07 g/mol |
| Exact Mass | 824.39 |
| IUPAC Name | N-[1-[3-(4-carbazol-9-ylphenyl)-5-(2,6-diphenylpyrimidin-4-yl)phenyl]-3-phenylprop-1-enyl]-2-methyl-1-phenylbutan-1-imine |
| SMILES | CCC(C)/C(=N\C(=CCc1ccccc1)c1cc(-c2ccc(-n3c4ccccc4c4ccccc43)cc2)cc(-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)c1)c1ccccc1 |
| InChI | InChI=1S/C60H48N4/c1-3-42(2)59(46-24-12-6-13-25-46)61-54(37-32-43-20-8-4-9-21-43)49-38-48(44-33-35-51(36-34-44)64-57-30-18-16-28-52(57)53-29-17-19-31-58(53)64)39-50(40-49)56-41-55(45-22-10-5-11-23-45)62-60(63-56)47-26-14-7-15-27-47/h4-31,33-42H,3,32H2,1-2H3/b54-37?,61-59+ |
| InChIKey | OUAJJSCJEKYLLP-SSAMFIQZSA-N |
| XLogP | 15.36 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.07 |
| LogP ≤ 5 | 15.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|