About 4-iodo-2-oxobutanal
4-iodo-2-oxobutanal (PubChem CID 123923901) has the molecular formula C4H5IO2
and a molecular weight of 211.99 g/mol. Its IUPAC name is 4-iodo-2-oxobutanal.
Molecular Properties
| Compound Name | 4-iodo-2-oxobutanal |
| PubChem CID | 123923901 |
| Molecular Formula | C4H5IO2 |
| Molecular Weight | 211.99 g/mol |
| Exact Mass | 211.93 |
| IUPAC Name | 4-iodo-2-oxobutanal |
| SMILES | O=CC(=O)CCI |
| InChI | InChI=1S/C4H5IO2/c5-2-1-4(7)3-6/h3H,1-2H2 |
| InChIKey | ILCXRJNFFUMNAZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.99 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-2-oxobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-2-oxobutanal?
The IUPAC name of 4-iodo-2-oxobutanal (CID 123923901) is 4-iodo-2-oxobutanal.
What is the SMILES notation for 4-iodo-2-oxobutanal?
The canonical SMILES for 4-iodo-2-oxobutanal is O=CC(=O)CCI.
What is the InChIKey of 4-iodo-2-oxobutanal?
The InChIKey is ILCXRJNFFUMNAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5IO2/c5-2-1-4(7)3-6/h3H,1-2H2.
What are the key properties of 4-iodo-2-oxobutanal?
4-iodo-2-oxobutanal has a molecular weight of 211.99 g/mol, XLogP of 0.58, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-2-oxobutanal is sourced from PubChem (CID 123923901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).