C24H23Cl2N3O4 — CID 123924696
3-[5-[6-amino-5-[1-(2,5-dichlorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol (PubChem CID 123924696) has the molecular formula C24H23Cl2N3O4 and a molecular weight of 488.37 g/mol. Its IUPAC name is 3-[5-[6-amino-5-[1-(2,5-dichlorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol.
| Compound Name | 3-[5-[6-amino-5-[1-(2,5-dichlorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
|---|---|
| PubChem CID | 123924696 |
| Molecular Formula | C24H23Cl2N3O4 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 3-[5-[6-amino-5-[1-(2,5-dichlorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
| SMILES | CC(Oc1cc(-c2ccc(C3COC4C(O)COC34)nc2)cnc1N)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C24H23Cl2N3O4/c1-12(16-7-15(25)3-4-18(16)26)33-21-6-14(9-29-24(21)27)13-2-5-19(28-8-13)17-10-31-23-20(30)11-32-22(17)23/h2-9,12,17,20,22-23,30H,10-11H2,1H3,(H2,27,29) |
| InChIKey | KZRDNMMZYNTANX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |