About 2-(2-benzoylanilino)-2,4-dimethylheptanoic acid
2-(2-benzoylanilino)-2,4-dimethylheptanoic acid (PubChem CID 123926215) has the molecular formula C22H27NO3
and a molecular weight of 353.46 g/mol. Its IUPAC name is 2-(2-benzoylanilino)-2,4-dimethylheptanoic acid.
Molecular Properties
| Compound Name | 2-(2-benzoylanilino)-2,4-dimethylheptanoic acid |
| PubChem CID | 123926215 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 2-(2-benzoylanilino)-2,4-dimethylheptanoic acid |
| SMILES | CCCC(C)CC(C)(Nc1ccccc1C(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H27NO3/c1-4-10-16(2)15-22(3,21(25)26)23-19-14-9-8-13-18(19)20(24)17-11-6-5-7-12-17/h5-9,11-14,16,23H,4,10,15H2,1-3H3,(H,25,26) |
| InChIKey | YBCWQHAYSKGZHY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-benzoylanilino)-2,4-dimethylheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-benzoylanilino)-2,4-dimethylheptanoic acid?
The IUPAC name of 2-(2-benzoylanilino)-2,4-dimethylheptanoic acid (CID 123926215) is 2-(2-benzoylanilino)-2,4-dimethylheptanoic acid.
What is the SMILES notation for 2-(2-benzoylanilino)-2,4-dimethylheptanoic acid?
The canonical SMILES for 2-(2-benzoylanilino)-2,4-dimethylheptanoic acid is CCCC(C)CC(C)(Nc1ccccc1C(=O)c1ccccc1)C(=O)O.
What is the InChIKey of 2-(2-benzoylanilino)-2,4-dimethylheptanoic acid?
The InChIKey is YBCWQHAYSKGZHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO3/c1-4-10-16(2)15-22(3,21(25)26)23-19-14-9-8-13-18(19)20(24)17-11-6-5-7-12-17/h5-9,11-14,16,23H,4,10,15H2,1-3H3,(H,25,26).
What are the key properties of 2-(2-benzoylanilino)-2,4-dimethylheptanoic acid?
2-(2-benzoylanilino)-2,4-dimethylheptanoic acid has a molecular weight of 353.46 g/mol, XLogP of 5.00, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-benzoylanilino)-2,4-dimethylheptanoic acid is sourced from PubChem (CID 123926215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).