C8H14S — CID 123926268
2-buta-1,3-dien-2-ylsulfanylbutane (PubChem CID 123926268) has the molecular formula C8H14S and a molecular weight of 142.27 g/mol. Its IUPAC name is 2-buta-1,3-dien-2-ylsulfanylbutane.
| Compound Name | 2-buta-1,3-dien-2-ylsulfanylbutane |
|---|---|
| PubChem CID | 123926268 |
| Molecular Formula | C8H14S |
| Molecular Weight | 142.27 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | 2-buta-1,3-dien-2-ylsulfanylbutane |
| SMILES | C=CC(=C)SC(C)CC |
| InChI | InChI=1S/C8H14S/c1-5-7(3)9-8(4)6-2/h5,8H,1,3,6H2,2,4H3 |
| InChIKey | CZWVDRBUFSCDFB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|