About 6-methoxy-N,N-dimethyl-5-propan-2-ylpyridazin-3-amine
6-methoxy-N,N-dimethyl-5-propan-2-ylpyridazin-3-amine (PubChem CID 123926862) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is 6-methoxy-N,N-dimethyl-5-propan-2-ylpyridazin-3-amine.
Molecular Properties
| Compound Name | 6-methoxy-N,N-dimethyl-5-propan-2-ylpyridazin-3-amine |
| PubChem CID | 123926862 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 6-methoxy-N,N-dimethyl-5-propan-2-ylpyridazin-3-amine |
| SMILES | COc1nnc(N(C)C)cc1C(C)C |
| InChI | InChI=1S/C10H17N3O/c1-7(2)8-6-9(13(3)4)11-12-10(8)14-5/h6-7H,1-5H3 |
| InChIKey | DTZIWIQKNDDTAX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methoxy-N,N-dimethyl-5-propan-2-ylpyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-N,N-dimethyl-5-propan-2-ylpyridazin-3-amine?
The IUPAC name of 6-methoxy-N,N-dimethyl-5-propan-2-ylpyridazin-3-amine (CID 123926862) is 6-methoxy-N,N-dimethyl-5-propan-2-ylpyridazin-3-amine.
What is the SMILES notation for 6-methoxy-N,N-dimethyl-5-propan-2-ylpyridazin-3-amine?
The canonical SMILES for 6-methoxy-N,N-dimethyl-5-propan-2-ylpyridazin-3-amine is COc1nnc(N(C)C)cc1C(C)C.
What is the InChIKey of 6-methoxy-N,N-dimethyl-5-propan-2-ylpyridazin-3-amine?
The InChIKey is DTZIWIQKNDDTAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O/c1-7(2)8-6-9(13(3)4)11-12-10(8)14-5/h6-7H,1-5H3.
What are the key properties of 6-methoxy-N,N-dimethyl-5-propan-2-ylpyridazin-3-amine?
6-methoxy-N,N-dimethyl-5-propan-2-ylpyridazin-3-amine has a molecular weight of 195.27 g/mol, XLogP of 1.67, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-N,N-dimethyl-5-propan-2-ylpyridazin-3-amine is sourced from PubChem (CID 123926862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).