C16H24O3 — CID 123927001
2'-methoxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,6,7-tetrahydro-1H-indene-2,3'-oxolane]-1-ol (PubChem CID 123927001) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 2'-methoxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,6,7-tetrahydro-1H-indene-2,3'-oxolane]-1-ol.
| Compound Name | 2'-methoxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,6,7-tetrahydro-1H-indene-2,3'-oxolane]-1-ol |
|---|---|
| PubChem CID | 123927001 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2'-methoxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,6,7-tetrahydro-1H-indene-2,3'-oxolane]-1-ol |
| SMILES | C=C1COC(OC)C12CC1C=CCC(C)C1(C)C2O |
| InChI | InChI=1S/C16H24O3/c1-10-6-5-7-12-8-16(13(17)15(10,12)3)11(2)9-19-14(16)18-4/h5,7,10,12-14,17H,2,6,8-9H2,1,3-4H3 |
| InChIKey | CYESBLPEOLIEOK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|