C23H35BN2O5S — CID 123927014
[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl N-[3-[(3-sulfanylpropanoylamino)methyl]cyclopentyl]carbamate (PubChem CID 123927014) has the molecular formula C23H35BN2O5S and a molecular weight of 462.42 g/mol. Its IUPAC name is [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl N-[3-[(3-sulfanylpropanoylamino)methyl]cyclopentyl]carbamate.
| Compound Name | [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl N-[3-[(3-sulfanylpropanoylamino)methyl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 123927014 |
| Molecular Formula | C23H35BN2O5S |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl N-[3-[(3-sulfanylpropanoylamino)methyl]cyclopentyl]carbamate |
| SMILES | CC1(C)OB(c2cccc(COC(=O)NC3CCC(CNC(=O)CCS)C3)c2)OC1(C)C |
| InChI | InChI=1S/C23H35BN2O5S/c1-22(2)23(3,4)31-24(30-22)18-7-5-6-17(12-18)15-29-21(28)26-19-9-8-16(13-19)14-25-20(27)10-11-32/h5-7,12,16,19,32H,8-11,13-15H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | VDMTZAWZBJNTDA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|