C7H13NO2 — CID 123927031
4-ethyl-6-methyl-1,3-oxazinan-2-one (PubChem CID 123927031) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is 4-ethyl-6-methyl-1,3-oxazinan-2-one.
| Compound Name | 4-ethyl-6-methyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 123927031 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 4-ethyl-6-methyl-1,3-oxazinan-2-one |
| SMILES | CCC1CC(C)OC(=O)N1 |
| InChI | InChI=1S/C7H13NO2/c1-3-6-4-5(2)10-7(9)8-6/h5-6H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | PQEIFGBXRXMKQL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |