C4H10N6 — CID 123927075
5-imino-4,6-dihydropyrimidine-1,2,6-triamine (PubChem CID 123927075) has the molecular formula C4H10N6 and a molecular weight of 142.17 g/mol. Its IUPAC name is 5-imino-4,6-dihydropyrimidine-1,2,6-triamine.
| Compound Name | 5-imino-4,6-dihydropyrimidine-1,2,6-triamine |
|---|---|
| PubChem CID | 123927075 |
| Molecular Formula | C4H10N6 |
| Molecular Weight | 142.17 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 5-imino-4,6-dihydropyrimidine-1,2,6-triamine |
| SMILES | [H]/N=C1\CN=C(N)N(N)C1N |
| InChI | InChI=1S/C4H10N6/c5-2-1-9-4(7)10(8)3(2)6/h3,5H,1,6,8H2,(H2,7,9)/b5-2+ |
| InChIKey | QDTDRJHFDOUBCL-GORDUTHDSA-N |
| XLogP | -2.21 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.17 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|