C35H41F2NO7S — CID 123927514
ethyl 4-[3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-4,4-difluoro-2-sulfanylbutanoate (PubChem CID 123927514) has the molecular formula C35H41F2NO7S and a molecular weight of 657.78 g/mol. Its IUPAC name is ethyl 4-[3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-4,4-difluoro-2-sulfanylbutanoate.
| Compound Name | ethyl 4-[3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-4,4-difluoro-2-sulfanylbutanoate |
|---|---|
| PubChem CID | 123927514 |
| Molecular Formula | C35H41F2NO7S |
| Molecular Weight | 657.78 g/mol |
| Exact Mass | 657.26 |
| IUPAC Name | ethyl 4-[3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-4,4-difluoro-2-sulfanylbutanoate |
| SMILES | CCOC(=O)C(S)CC(F)(F)C1OC(COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1NC(C)=O |
| InChI | InChI=1S/C35H41F2NO7S/c1-3-42-34(40)29(46)19-35(36,37)33-30(38-24(2)39)32(44-22-27-17-11-6-12-18-27)31(43-21-26-15-9-5-10-16-26)28(45-33)23-41-20-25-13-7-4-8-14-25/h4-18,28-33,46H,3,19-23H2,1-2H3,(H,38,39) |
| InChIKey | WSVDREUIPDVBAY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.78 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|