C19H20FNO4 — CID 123927760
methyl 4-[2-(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)ethynyl]cyclohexane-1-carboxylate (PubChem CID 123927760) has the molecular formula C19H20FNO4 and a molecular weight of 345.37 g/mol. Its IUPAC name is methyl 4-[2-(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)ethynyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[2-(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)ethynyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 123927760 |
| Molecular Formula | C19H20FNO4 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | methyl 4-[2-(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)ethynyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(C#CN2Cc3ccc(OC)c(F)c3C2=O)CC1 |
| InChI | InChI=1S/C19H20FNO4/c1-24-15-8-7-14-11-21(18(22)16(14)17(15)20)10-9-12-3-5-13(6-4-12)19(23)25-2/h7-8,12-13H,3-6,11H2,1-2H3 |
| InChIKey | SIZBPWDKJFWTRT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|