C29H29N5O4S — CID 123927871
1-[3-[2-(4-benzyl-2-methylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]-3-(4-hydroxysulfanylphenyl)urea (PubChem CID 123927871) has the molecular formula C29H29N5O4S and a molecular weight of 543.65 g/mol. Its IUPAC name is 1-[3-[2-(4-benzyl-2-methylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]-3-(4-hydroxysulfanylphenyl)urea.
| Compound Name | 1-[3-[2-(4-benzyl-2-methylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]-3-(4-hydroxysulfanylphenyl)urea |
|---|---|
| PubChem CID | 123927871 |
| Molecular Formula | C29H29N5O4S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | 1-[3-[2-(4-benzyl-2-methylpiperazin-1-yl)-2-oxoacetyl]-1H-indol-7-yl]-3-(4-hydroxysulfanylphenyl)urea |
| SMILES | CC1CN(Cc2ccccc2)CCN1C(=O)C(=O)c1c[nH]c2c(NC(=O)Nc3ccc(SO)cc3)cccc12 |
| InChI | InChI=1S/C29H29N5O4S/c1-19-17-33(18-20-6-3-2-4-7-20)14-15-34(19)28(36)27(35)24-16-30-26-23(24)8-5-9-25(26)32-29(37)31-21-10-12-22(39-38)13-11-21/h2-13,16,19,30,38H,14-15,17-18H2,1H3,(H2,31,32,37) |
| InChIKey | WXWQHAGOAYDTEB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|