About 1-[butylamino(hydroxy)methyl]-5-(difluoromethyl)piperidine-3,4-diol
1-[butylamino(hydroxy)methyl]-5-(difluoromethyl)piperidine-3,4-diol (PubChem CID 123928023) has the molecular formula C11H22F2N2O3
and a molecular weight of 268.30 g/mol. Its IUPAC name is 1-[butylamino(hydroxy)methyl]-5-(difluoromethyl)piperidine-3,4-diol.
Molecular Properties
| Compound Name | 1-[butylamino(hydroxy)methyl]-5-(difluoromethyl)piperidine-3,4-diol |
| PubChem CID | 123928023 |
| Molecular Formula | C11H22F2N2O3 |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-[butylamino(hydroxy)methyl]-5-(difluoromethyl)piperidine-3,4-diol |
| SMILES | CCCCNC(O)N1CC(O)C(O)C(C(F)F)C1 |
| InChI | InChI=1S/C11H22F2N2O3/c1-2-3-4-14-11(18)15-5-7(10(12)13)9(17)8(16)6-15/h7-11,14,16-18H,2-6H2,1H3 |
| InChIKey | GSSRDXADYMUFSF-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[butylamino(hydroxy)methyl]-5-(difluoromethyl)piperidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[butylamino(hydroxy)methyl]-5-(difluoromethyl)piperidine-3,4-diol?
The IUPAC name of 1-[butylamino(hydroxy)methyl]-5-(difluoromethyl)piperidine-3,4-diol (CID 123928023) is 1-[butylamino(hydroxy)methyl]-5-(difluoromethyl)piperidine-3,4-diol.
What is the SMILES notation for 1-[butylamino(hydroxy)methyl]-5-(difluoromethyl)piperidine-3,4-diol?
The canonical SMILES for 1-[butylamino(hydroxy)methyl]-5-(difluoromethyl)piperidine-3,4-diol is CCCCNC(O)N1CC(O)C(O)C(C(F)F)C1.
What is the InChIKey of 1-[butylamino(hydroxy)methyl]-5-(difluoromethyl)piperidine-3,4-diol?
The InChIKey is GSSRDXADYMUFSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F2N2O3/c1-2-3-4-14-11(18)15-5-7(10(12)13)9(17)8(16)6-15/h7-11,14,16-18H,2-6H2,1H3.
What are the key properties of 1-[butylamino(hydroxy)methyl]-5-(difluoromethyl)piperidine-3,4-diol?
1-[butylamino(hydroxy)methyl]-5-(difluoromethyl)piperidine-3,4-diol has a molecular weight of 268.30 g/mol, XLogP of -0.43, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[butylamino(hydroxy)methyl]-5-(difluoromethyl)piperidine-3,4-diol is sourced from PubChem (CID 123928023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).