C18H21Cl2N3O5 — CID 123928074
[4-(1-chloroethylideneamino)-5-methoxy-5-oxopent-3-enyl] 4-chloro-6-morpholin-4-ylpyridine-2-carboxylate (PubChem CID 123928074) has the molecular formula C18H21Cl2N3O5 and a molecular weight of 430.29 g/mol. Its IUPAC name is [4-(1-chloroethylideneamino)-5-methoxy-5-oxopent-3-enyl] 4-chloro-6-morpholin-4-ylpyridine-2-carboxylate.
| Compound Name | [4-(1-chloroethylideneamino)-5-methoxy-5-oxopent-3-enyl] 4-chloro-6-morpholin-4-ylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 123928074 |
| Molecular Formula | C18H21Cl2N3O5 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | [4-(1-chloroethylideneamino)-5-methoxy-5-oxopent-3-enyl] 4-chloro-6-morpholin-4-ylpyridine-2-carboxylate |
| SMILES | COC(=O)C(=CCCOC(=O)c1cc(Cl)cc(N2CCOCC2)n1)/N=C(\C)Cl |
| InChI | InChI=1S/C18H21Cl2N3O5/c1-12(19)21-14(17(24)26-2)4-3-7-28-18(25)15-10-13(20)11-16(22-15)23-5-8-27-9-6-23/h4,10-11H,3,5-9H2,1-2H3/b14-4?,21-12+ |
| InChIKey | KRBOORDDFUSFMU-NYTADHFXSA-N |
| XLogP | 2.83 |
| TPSA | 90.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|