C9H8F2N2S — CID 123928719
5-(1,1-difluoroethyl)-3-thiophen-2-yl-1H-pyrazole (PubChem CID 123928719) has the molecular formula C9H8F2N2S and a molecular weight of 214.24 g/mol. Its IUPAC name is 5-(1,1-difluoroethyl)-3-thiophen-2-yl-1H-pyrazole.
| Compound Name | 5-(1,1-difluoroethyl)-3-thiophen-2-yl-1H-pyrazole |
|---|---|
| PubChem CID | 123928719 |
| Molecular Formula | C9H8F2N2S |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 5-(1,1-difluoroethyl)-3-thiophen-2-yl-1H-pyrazole |
| SMILES | CC(F)(F)c1cc(-c2cccs2)n[nH]1 |
| InChI | InChI=1S/C9H8F2N2S/c1-9(10,11)8-5-6(12-13-8)7-3-2-4-14-7/h2-5H,1H3,(H,12,13) |
| InChIKey | VGPITMYGZWPFCA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |