C32H44Cl2N2O9 — CID 123928863
(1,9-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl) 4-[[3-[4-[bis(2-chloroethyl)amino]phenyl]-1-methoxy-1-oxopropan-2-yl]amino]-4-oxobutanoate (PubChem CID 123928863) has the molecular formula C32H44Cl2N2O9 and a molecular weight of 671.62 g/mol. Its IUPAC name is (1,9-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl) 4-[[3-[4-[bis(2-chloroethyl)amino]phenyl]-1-methoxy-1-oxopropan-2-yl]amino]-4-oxobutanoate.
| Compound Name | (1,9-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl) 4-[[3-[4-[bis(2-chloroethyl)amino]phenyl]-1-methoxy-1-oxopropan-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 123928863 |
| Molecular Formula | C32H44Cl2N2O9 |
| Molecular Weight | 671.62 g/mol |
| Exact Mass | 670.24 |
| IUPAC Name | (1,9-dimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl) 4-[[3-[4-[bis(2-chloroethyl)amino]phenyl]-1-methoxy-1-oxopropan-2-yl]amino]-4-oxobutanoate |
| SMILES | COC(=O)C(Cc1ccc(N(CCCl)CCCl)cc1)NC(=O)CCC(=O)OC1OC2OC3(C)CCC4CCCC(C1C)C42OO3 |
| InChI | InChI=1S/C32H44Cl2N2O9/c1-20-24-6-4-5-22-13-14-31(2)43-30(32(22,24)45-44-31)42-29(20)41-27(38)12-11-26(37)35-25(28(39)40-3)19-21-7-9-23(10-8-21)36(17-15-33)18-16-34/h7-10,20,22,24-25,29-30H,4-6,11-19H2,1-3H3,(H,35,37) |
| InChIKey | LPXMTMSUOOGYMF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.62 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|