C23H40O4 — CID 123929277
2-[4-(2,3-dimethylbutan-2-yloxy)-4-methylcyclohexyl]propan-2-yl 3,3-dimethyl-2-oxopent-4-enoate (PubChem CID 123929277) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is 2-[4-(2,3-dimethylbutan-2-yloxy)-4-methylcyclohexyl]propan-2-yl 3,3-dimethyl-2-oxopent-4-enoate.
| Compound Name | 2-[4-(2,3-dimethylbutan-2-yloxy)-4-methylcyclohexyl]propan-2-yl 3,3-dimethyl-2-oxopent-4-enoate |
|---|---|
| PubChem CID | 123929277 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 2-[4-(2,3-dimethylbutan-2-yloxy)-4-methylcyclohexyl]propan-2-yl 3,3-dimethyl-2-oxopent-4-enoate |
| SMILES | C=CC(C)(C)C(=O)C(=O)OC(C)(C)C1CCC(C)(OC(C)(C)C(C)C)CC1 |
| InChI | InChI=1S/C23H40O4/c1-11-20(4,5)18(24)19(25)26-22(8,9)17-12-14-23(10,15-13-17)27-21(6,7)16(2)3/h11,16-17H,1,12-15H2,2-10H3 |
| InChIKey | DONLRHKCAIATNA-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|