C17H17F3N2O2 — CID 123930003
3,6-dimethoxy-2-propan-2-yl-5-[2-(2,4,5-trifluorophenyl)ethynyl]-2,5-dihydropyrazine (PubChem CID 123930003) has the molecular formula C17H17F3N2O2 and a molecular weight of 338.33 g/mol. Its IUPAC name is 3,6-dimethoxy-2-propan-2-yl-5-[2-(2,4,5-trifluorophenyl)ethynyl]-2,5-dihydropyrazine.
| Compound Name | 3,6-dimethoxy-2-propan-2-yl-5-[2-(2,4,5-trifluorophenyl)ethynyl]-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 123930003 |
| Molecular Formula | C17H17F3N2O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 3,6-dimethoxy-2-propan-2-yl-5-[2-(2,4,5-trifluorophenyl)ethynyl]-2,5-dihydropyrazine |
| SMILES | COC1=NC(C(C)C)C(OC)=NC1C#Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H17F3N2O2/c1-9(2)15-17(24-4)21-14(16(22-15)23-3)6-5-10-7-12(19)13(20)8-11(10)18/h7-9,14-15H,1-4H3 |
| InChIKey | LNAXTOGDBSACGL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|