C6H12N2O3S — CID 123930229
4-amino-5-(methylsulfanylamino)-5-oxopentanoic acid (PubChem CID 123930229) has the molecular formula C6H12N2O3S and a molecular weight of 192.24 g/mol. Its IUPAC name is 4-amino-5-(methylsulfanylamino)-5-oxopentanoic acid.
| Compound Name | 4-amino-5-(methylsulfanylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123930229 |
| Molecular Formula | C6H12N2O3S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 4-amino-5-(methylsulfanylamino)-5-oxopentanoic acid |
| SMILES | CSNC(=O)C(N)CCC(=O)O |
| InChI | InChI=1S/C6H12N2O3S/c1-12-8-6(11)4(7)2-3-5(9)10/h4H,2-3,7H2,1H3,(H,8,11)(H,9,10) |
| InChIKey | FAQGYYKLRPBEPN-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|