C16H20Cl3NO10 — CID 123930665
[(3R,4S,5S)-4,5-diacetyl-3-formyl-4,5,7,8-tetrahydroxy-2,6-dioxononan-3-yl] 2,2,2-trichloroethanimidate (PubChem CID 123930665) has the molecular formula C16H20Cl3NO10 and a molecular weight of 492.69 g/mol. Its IUPAC name is [(3R,4S,5S)-4,5-diacetyl-3-formyl-4,5,7,8-tetrahydroxy-2,6-dioxononan-3-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3R,4S,5S)-4,5-diacetyl-3-formyl-4,5,7,8-tetrahydroxy-2,6-dioxononan-3-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 123930665 |
| Molecular Formula | C16H20Cl3NO10 |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 491.02 |
| IUPAC Name | [(3R,4S,5S)-4,5-diacetyl-3-formyl-4,5,7,8-tetrahydroxy-2,6-dioxononan-3-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@](C=O)(C(C)=O)[C@](O)(C(C)=O)[C@](O)(C(C)=O)C(=O)C(O)C(C)O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H20Cl3NO10/c1-6(22)10(26)11(27)14(28,8(3)24)15(29,9(4)25)13(5-21,7(2)23)30-12(20)16(17,18)19/h5-6,10,20,22,26,28-29H,1-4H3/b20-12+/t6?,10?,13-,14+,15-/m1/s1 |
| InChIKey | WGSWEEIYIXZOOT-LKUUZHNJSA-N |
| XLogP | -1.17 |
| TPSA | 199.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|