C10H12F9N3O8S3 — CID 123931145
1,1,2,2,3,3-hexafluoro-N-[2-[(2-oxooxolan-3-yl)amino]ethyl]-N'-(trifluoromethylsulfonyl)propane-1,3-disulfonamide (PubChem CID 123931145) has the molecular formula C10H12F9N3O8S3 and a molecular weight of 569.40 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-N-[2-[(2-oxooxolan-3-yl)amino]ethyl]-N'-(trifluoromethylsulfonyl)propane-1,3-disulfonamide.
| Compound Name | 1,1,2,2,3,3-hexafluoro-N-[2-[(2-oxooxolan-3-yl)amino]ethyl]-N'-(trifluoromethylsulfonyl)propane-1,3-disulfonamide |
|---|---|
| PubChem CID | 123931145 |
| Molecular Formula | C10H12F9N3O8S3 |
| Molecular Weight | 569.40 g/mol |
| Exact Mass | 568.96 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-N-[2-[(2-oxooxolan-3-yl)amino]ethyl]-N'-(trifluoromethylsulfonyl)propane-1,3-disulfonamide |
| SMILES | O=C1OCCC1NCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H12F9N3O8S3/c11-7(12,9(15,16)32(26,27)22-33(28,29)10(17,18)19)8(13,14)31(24,25)21-3-2-20-5-1-4-30-6(5)23/h5,20-22H,1-4H2 |
| InChIKey | KIQHZFYIHXDNRY-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 164.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.40 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|