C27H34F4N3O4Si+ — CID 123931911
3-[[5-[3-fluoro-4-[5-(trifluoromethyl)-3-(2-trimethylsilylethoxymethyl)-1H-imidazol-3-ium-2-yl]phenyl]-4-methyl-2-pyridinyl]oxy]-2,2-dimethylpropanoic acid (PubChem CID 123931911) has the molecular formula C27H34F4N3O4Si+ and a molecular weight of 568.66 g/mol. Its IUPAC name is 3-[[5-[3-fluoro-4-[5-(trifluoromethyl)-3-(2-trimethylsilylethoxymethyl)-1H-imidazol-3-ium-2-yl]phenyl]-4-methyl-2-pyridinyl]oxy]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[[5-[3-fluoro-4-[5-(trifluoromethyl)-3-(2-trimethylsilylethoxymethyl)-1H-imidazol-3-ium-2-yl]phenyl]-4-methyl-2-pyridinyl]oxy]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 123931911 |
| Molecular Formula | C27H34F4N3O4Si+ |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | 3-[[5-[3-fluoro-4-[5-(trifluoromethyl)-3-(2-trimethylsilylethoxymethyl)-1H-imidazol-3-ium-2-yl]phenyl]-4-methyl-2-pyridinyl]oxy]-2,2-dimethylpropanoic acid |
| SMILES | Cc1cc(OCC(C)(C)C(=O)O)ncc1-c1ccc(-c2[nH]c(C(F)(F)F)c[n+]2COCC[Si](C)(C)C)c(F)c1 |
| InChI | InChI=1S/C27H33F4N3O4Si/c1-17-11-23(38-15-26(2,3)25(35)36)32-13-20(17)18-7-8-19(21(28)12-18)24-33-22(27(29,30)31)14-34(24)16-37-9-10-39(4,5)6/h7-8,11-14H,9-10,15-16H2,1-6H3,(H,35,36)/p+1 |
| InChIKey | OHWLFVONLZFVIX-UHFFFAOYSA-O |
| XLogP | 6.30 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|